Difference between revisions of "PWY-2181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2181 PWY-2181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2181 PWY-2181] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
+
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
 
* common name:
 
* common name:
−
** free phenylpropanoid acid biosynthesis
+
** dioleoyl phosphatidate
 +
* molecular weight:
 +
** 698.959   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:1-18:1-PA
 +
** 1-18:1-2-18:1-phosphatidic acid
 +
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 +
** 1-18:1-2-18:1-phosphatidate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-15068]]
−
* [[RXN-1104]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
* [[RXN-15043]]
−
*** [[Ec-01_004720]]
+
== Reaction(s) of unknown directionality ==
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-1121]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-00_005850]]
+
−
*** [[Ec-10_006240]]
+
−
*** [[Ec-00_005820]]
+
−
*** [[Ec-07_001290]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-3422]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-01_004720]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1103 RXN-1103]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2181 PWY-2181]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245731 25245731]
−
{{#set: taxonomic range=TAX-58024}}
+
* CHEBI:
−
{{#set: common name=free phenylpropanoid acid biosynthesis}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
−
{{#set: reaction found=3}}
+
* HMDB : HMDB07865
−
{{#set: total reaction=4}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
−
{{#set: completion rate=75.0}}
+
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
 +
{{#set: common name=dioleoyl phosphatidate}}
 +
{{#set: molecular weight=698.959    }}
 +
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
 +
{{#set: consumed by=RXN-15068}}
 +
{{#set: produced by=RXN-15043}}

Revision as of 14:11, 21 March 2018

Metabolite CPD-8268

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
  • inchi key:
    • InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
  • common name:
    • dioleoyl phosphatidate
  • molecular weight:
    • 698.959
  • Synonym(s):
    • 18:1-18:1-PA
    • 1-18:1-2-18:1-phosphatidic acid
    • 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
    • 1-18:1-2-18:1-phosphatidate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-2181&oldid=16297"