Difference between revisions of "PWY-2181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2181 PWY-2181] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2181 PWY-2181] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
* inchi key:
+
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
+
 
* common name:
 
* common name:
** dioleoyl phosphatidate
+
** free phenylpropanoid acid biosynthesis
* molecular weight:
+
** 698.959   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:1-18:1-PA
 
** 1-18:1-2-18:1-phosphatidic acid
 
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 
** 1-18:1-2-18:1-phosphatidate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-15068]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-1104]]
* [[RXN-15043]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-01_004720]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-1121]]
 +
** 4 associated gene(s):
 +
*** [[Ec-07_001290]]
 +
*** [[Ec-00_005850]]
 +
*** [[Ec-00_005820]]
 +
*** [[Ec-10_006240]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN-3422]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_004720]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1103 RXN-1103]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245731 25245731]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-2181 PWY-2181]
* CHEBI:
+
{{#set: taxonomic range=TAX-58024}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
+
{{#set: common name=free phenylpropanoid acid biosynthesis}}
* HMDB : HMDB07865
+
{{#set: reaction found=3}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
+
{{#set: total reaction=4}}
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
+
{{#set: completion rate=75.0}}
{{#set: common name=dioleoyl phosphatidate}}
+
{{#set: molecular weight=698.959    }}
+
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
+
{{#set: consumed by=RXN-15068}}
+
{{#set: produced by=RXN-15043}}
+

Latest revision as of 20:00, 21 March 2018

Pathway PWY-2181

  • taxonomic range:
  • common name:
    • free phenylpropanoid acid biosynthesis
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links