Difference between revisions of "PWY-2722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3385 PWY-3385] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3385 PWY-3385] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4126 CPD-4126] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
 
* common name:
 
* common name:
** choline biosynthesis I
+
** 5-dehydroavenasterol
 +
* molecular weight:
 +
** 410.682   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-4210]]
* [[ETHANOLAMINE-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 1 associated gene(s):
+
* [[RXN-4209]]
*** [[Ec-16_004110]]
+
== Reaction(s) of unknown directionality ==
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[RXN-5641]]
+
** 0 associated gene:
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.103-RXN 2.1.1.103-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5642 RXN-5642]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5643 RXN-5643]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5647 RXN-5647]
+
 
== External links  ==
 
== External links  ==
* ARACYC:
+
* PUBCHEM:
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3385 PWY-3385]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724575 23724575]
{{#set: taxonomic range=TAX-33090}}
+
* CHEBI:
{{#set: common name=choline biosynthesis I}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80097 80097]
{{#set: reaction found=2}}
+
* LIGAND-CPD:
{{#set: total reaction=6}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15783 C15783]
{{#set: completion rate=33.0}}
+
* HMDB : HMDB06852
 +
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N}}
 +
{{#set: common name=5-dehydroavenasterol}}
 +
{{#set: molecular weight=410.682    }}
 +
{{#set: consumed by=RXN-4210}}
 +
{{#set: produced by=RXN-4209}}

Revision as of 14:27, 21 March 2018

Metabolite CPD-4126

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=XPRWWANUPMYKMF-HVEGQNEHSA-N
  • common name:
    • 5-dehydroavenasterol
  • molecular weight:
    • 410.682
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.