Difference between revisions of "PWY-3641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
* inchi key:
+
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
+
 
* common name:
 
* common name:
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
+
** L-carnitine degradation III
* molecular weight:
+
** 443.688   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-18]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.39-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-01_003680]]
 +
*** [[Ec-07_002070]]
 +
*** [[Ec-07_002060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-6002]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_002450]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5921 RXN-5921]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202943 25202943]
+
{{#set: common name=L-carnitine degradation III}}
* HMDB : HMDB12165
+
{{#set: reaction found=2}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: total reaction=3}}
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
+
{{#set: completion rate=67.0}}
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=443.688    }}
+
{{#set: consumed by=RXN66-18}}
+

Latest revision as of 20:21, 21 March 2018

Pathway PWY-3641

  • taxonomic range:
  • common name:
    • L-carnitine degradation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links