Difference between revisions of "PWY-4061"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7660 RXN-7660] == * direction: ** LEFT-TO-RIGHT * common name: ** Geranylgeranyl reductase * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
| − | ** | + | ** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J | ||
| + | * molecular weight: | ||
| + | ** 1051.975 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-16097]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-16096]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http://www. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409] |
| − | + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | {{#set: | + | {{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=1051.975 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-16097}} |
| + | {{#set: produced by=RXN-16096}} | ||
Revision as of 21:41, 17 March 2018
Contents
Metabolite CPD-17348
- smiles:
- CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
- inchi key:
- InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
- molecular weight:
- 1051.975
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
