Difference between revisions of "PWY-5133"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LARABITOLUTIL-PWY LARABITOLUTIL-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LARABITOLUTIL-PWY LARABITOLUTIL-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
−
** (22α)-hydroxy-campest-4-en-3-one
+
** xylitol degradation
−
* molecular weight:
+
−
** 414.67   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (22S)-22-hydroxy-campest-4-en-3-one
+
** L-arabitol and xylitol utilization
−
** (22S,24R)-22-hydroxy-ergost-4-en-3-one
+
** L-arabitol and xylitol degradation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
* [[RXN-4231]]
+
* [[XYLULOKIN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-01_002810]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=D-XYLULOSE-REDUCTASE-RXN D-XYLULOSE-REDUCTASE-RXN]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01031116
+
{{#set: taxonomic range=TAX-7742}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201842 25201842]
+
{{#set: taxonomic range=TAX-1224}}
−
* CHEBI:
+
{{#set: common name=xylitol degradation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330]
+
{{#set: common name=L-arabitol and xylitol utilization|L-arabitol and xylitol degradation}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796]
+
{{#set: total reaction=2}}
−
* HMDB : HMDB12113
+
{{#set: completion rate=50.0}}
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}}
+
−
{{#set: common name=(22α)-hydroxy-campest-4-en-3-one}}
+
−
{{#set: molecular weight=414.67    }}
+
−
{{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}}
+
−
{{#set: produced by=RXN-4231}}
+

Revision as of 14:17, 21 March 2018

Pathway LARABITOLUTIL-PWY

  • taxonomic range:
  • common name:
    • xylitol degradation
  • Synonym(s):
    • L-arabitol and xylitol utilization
    • L-arabitol and xylitol degradation

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5133&oldid=17252"