Difference between revisions of "PWY-5642"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18352 CPD-18352] == * smiles: ** CCCCCCC=CCCCCCCCCCC(OC(COC(=O)CCCCCCCCCCCCCCC)COP([O-])(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N |
* common name: | * common name: | ||
| − | ** | + | ** S-adenosyl-4-methylthio-2-oxobutanoate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 397.405 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[DAPASYN-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * PUBCHEM: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459852 5459852] |
| − | {{#set: common name= | + | * CHEMSPIDER: |
| − | {{#set: molecular weight= | + | ** [http://www.chemspider.com/Chemical-Structure.4573603.html 4573603] |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16490 16490] | |
| + | * BIGG : 43797 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04425 C04425] | ||
| + | {{#set: smiles=C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))}} | ||
| + | {{#set: inchi key=InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N}} | ||
| + | {{#set: common name=S-adenosyl-4-methylthio-2-oxobutanoate}} | ||
| + | {{#set: molecular weight=397.405 }} | ||
| + | {{#set: reversible reaction associated=DAPASYN-RXN}} | ||
Revision as of 21:40, 17 March 2018
Contents
Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE
- smiles:
- C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))
- inchi key:
- InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N
- common name:
- S-adenosyl-4-methylthio-2-oxobutanoate
- molecular weight:
- 397.405
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))" cannot be used as a page name in this wiki.
