Difference between revisions of "PWY-5652"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17758 RXN-17758] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17758 RXN-17758] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
 +
* inchi key:
 +
** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
 +
* common name:
 +
** ε-carotene
 +
* molecular weight:
 +
** 536.882   
 
* Synonym(s):
 
* Synonym(s):
 +
** ε,ε-carotene
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[E-]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[BETAINE_ALDEHYDE]][c] '''=>''' 1 [[CHOLINE]][c]
+
* [[RXN-8028]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
**
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}}
 +
{{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}}
 +
{{#set: common name=ε-carotene}}
 +
{{#set: molecular weight=536.882    }}
 +
{{#set: common name=ε,ε-carotene}}
 +
{{#set: produced by=RXN-8028}}

Revision as of 14:24, 21 March 2018

Metabolite CPD-7414

  • smiles:
    • CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
  • inchi key:
    • InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
  • common name:
    • ε-carotene
  • molecular weight:
    • 536.882
  • Synonym(s):
    • ε,ε-carotene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5652&oldid=18350"