Difference between revisions of "PWY-5754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * inchi key: ** InChIKey=OTOIIPJY...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] ==
* smiles:
+
* taxonomic range:
** CC(C)(CO)C(C([O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
+
 
* common name:
 
* common name:
** (R)-pantoate
+
** 4-hydroxybenzoate biosynthesis I (eukaryotes)
* molecular weight:
+
** 147.15   
+
 
* Synonym(s):
 
* Synonym(s):
** pantoate
+
** p-hydroxybenzoate biosynthesis I (eukaryotes)
** L-pantoate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
+
'''2''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_001480]]
 +
*** [[Ec-04_001280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1118 RXN3O-1118]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1120 RXN3O-1120]
 
== External links  ==
 
== External links  ==
* CAS : 470-29-1
+
{{#set: taxonomic range=TAX-2759}}
* DRUGBANK : DB01930
+
{{#set: common name=4-hydroxybenzoate biosynthesis I (eukaryotes)}}
* PUBCHEM:
+
{{#set: common name=p-hydroxybenzoate biosynthesis I (eukaryotes)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
+
{{#set: reaction found=2}}
* LIGAND-CPD:
+
{{#set: total reaction=6}}
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
+
{{#set: completion rate=33.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
+
* BIGG : 35240
+
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
+
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
+
{{#set: common name=(R)-pantoate}}
+
{{#set: molecular weight=147.15    }}
+
{{#set: common name=pantoate|L-pantoate}}
+
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
+
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+

Latest revision as of 20:34, 21 March 2018

Pathway PWY-5754

  • taxonomic range:
  • common name:
    • 4-hydroxybenzoate biosynthesis I (eukaryotes)
  • Synonym(s):
    • p-hydroxybenzoate biosynthesis I (eukaryotes)

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links