Difference between revisions of "PWY-6115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6115 PWY-6115] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4496 TAX-44...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6115 PWY-6115] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4496 TAX-4496] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** avenacin biosynthesis, initial reactions |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[CYCLOARTENOL-SYNTHASE-RXN]] | |
− | * [[ | + | ** 2 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-07_006170]] |
− | * [ | + | *** [[Ec-00_010980]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7570 RXN-7570] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4496}} | |
− | + | {{#set: common name=avenacin biosynthesis, initial reactions}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:28, 21 March 2018
Pathway PWY-6115
- taxonomic range:
- common name:
- avenacin biosynthesis, initial reactions
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- CYCLOARTENOL-SYNTHASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: