Difference between revisions of "PWY-6167"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6167 PWY-6167] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6167 PWY-6167] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** flavin biosynthesis II (archaea) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''4''' reactions found over '''10''' reactions in the full pathway | |
− | * [[RXN- | + | * [[DIOHBUTANONEPSYN-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-27_004040]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[FADSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_006670]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[LUMAZINESYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_002140]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RIBOFLAVIN-SYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-00_004570]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RIBOPHOSPHAT-RXN RIBOPHOSPHAT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10055 RXN-10055] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10056 RXN-10056] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10057 RXN-10057] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10058 RXN-10058] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9296 RXN-9296] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=flavin biosynthesis II (archaea)}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=40.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:06, 21 March 2018
Pathway PWY-6167
- taxonomic range:
- common name:
- flavin biosynthesis II (archaea)
- Synonym(s):
Reaction(s) found
4 reactions found over 10 reactions in the full pathway
- DIOHBUTANONEPSYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- FADSYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- LUMAZINESYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RIBOFLAVIN-SYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: