Difference between revisions of "PWY-6261"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-])) |
| + | * inchi key: | ||
| + | ** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 5-hydroxyindole acetate |
| + | * molecular weight: | ||
| + | ** 190.178 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5-hydroxyindoleacetic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN-10780]] |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 54-16-0 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821] |
| − | {{#set: | + | * HMDB : HMDB00763 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622] | ||
| + | {{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}} | ||
| + | {{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=5-hydroxyindole acetate}} | ||
| + | {{#set: molecular weight=190.178 }} | ||
| + | {{#set: common name=5-hydroxyindoleacetic acid}} | ||
| + | {{#set: produced by=RXN-10780}} | ||
Revision as of 20:44, 17 March 2018
Contents
Metabolite 5-HYDROXYINDOLE_ACETATE
- smiles:
- C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
- inchi key:
- InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
- common name:
- 5-hydroxyindole acetate
- molecular weight:
- 190.178
- Synonym(s):
- 5-hydroxyindoleacetic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))" cannot be used as a page name in this wiki.
