Difference between revisions of "PWY-6282"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** palmitoleic acid biosynthesis I |
− | ** | + | ** palmitoleate biosynthesis (anaerobic) |
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''9''' reactions found over '''9''' reactions in the full pathway | |
− | + | * [[RXN-10654]] | |
− | * [[ | + | ** 4 associated gene(s): |
+ | *** [[Ec-27_003480]] | ||
+ | *** [[Ec-12_000640]] | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-10655]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-10656]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-10657]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_002470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-10658]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Ec-12_000640]] | ||
+ | *** [[Ec-12_000650]] | ||
+ | *** [[Ec-27_002090]] | ||
+ | *** [[Ec-27_003480]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-10659]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_007100]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-10660]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | * [[RXN-10661]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_002470]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-9550]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6282 PWY-6282] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)}} | |
− | + | {{#set: common name=palmitoleic acid biosynthesis I|palmitoleate biosynthesis (anaerobic)}} | |
− | + | {{#set: reaction found=9}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=100.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:01, 21 March 2018
Pathway PWY-6282
- taxonomic range:
- common name:
- palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate)
- Synonym(s):
- palmitoleic acid biosynthesis I
- palmitoleate biosynthesis (anaerobic)
Reaction(s) found
9 reactions found over 9 reactions in the full pathway
- RXN-10654
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10655
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10656
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-10657
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10658
- 4 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10659
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10660
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-10661
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-9550
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: