Difference between revisions of "PWY-6416"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* common name: | * common name: | ||
− | ** | + | ** quinate degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] | |
− | == Reaction(s) | + | ** 4 associated gene(s): |
+ | *** [[Ec-07_000550]] | ||
+ | *** [[Ec-26_004120]] | ||
+ | *** [[Ec-14_005400]] | ||
+ | *** [[Ec-02_006010]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[QUINATE-5-DEHYDROGENASE-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DHSHIKIMATE-DEHYDRO-RXN DHSHIKIMATE-DEHYDRO-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: taxonomic range=TAX-201174}} | |
− | {{#set: | + | {{#set: taxonomic range=TAX-4751}} |
− | {{#set: | + | {{#set: common name=quinate degradation II}} |
− | {{#set: common name= | + | {{#set: reaction found=2}} |
− | {{#set: | + | {{#set: total reaction=3}} |
− | {{#set: | + | {{#set: completion rate=67.0}} |
Latest revision as of 20:33, 21 March 2018
Pathway PWY-6416
- taxonomic range:
- common name:
- quinate degradation II
- Synonym(s):
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- 3-DEHYDROQUINATE-DEHYDRATASE-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- QUINATE-5-DEHYDROGENASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated: