Difference between revisions of "PWY-6654"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-23_000740 == * left end position: ** 783119 * transcription direction: ** POSITIVE * right end position: ** 786402 * centisome position: ** 16.181...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_000740 == |
− | * | + | * left end position: |
− | ** | + | ** 783119 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 786402 |
− | * | + | * centisome position: |
− | ** | + | ** 16.181927 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0017_0108 |
− | ** | + | ** Esi0017_0108 |
+ | ** PP2A | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.1.3.16-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=783119}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=786402}} | |
− | + | {{#set: centisome position=16.181927 }} | |
− | + | {{#set: common name=Esi_0017_0108|Esi0017_0108|PP2A}} | |
− | + | {{#set: reaction associated=3.1.3.16-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 14:11, 21 March 2018
Gene Ec-23_000740
- left end position:
- 783119
- transcription direction:
- POSITIVE
- right end position:
- 786402
- centisome position:
- 16.181927
- Synonym(s):
- Esi_0017_0108
- Esi0017_0108
- PP2A
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome