Difference between revisions of "PWY-6707"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6707 PWY-6707] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6707 PWY-6707] ==
−
* smiles:
+
* taxonomic range:
−
** C(C([N+])C(=O)[O-])S(=O)(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
** InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** L-cysteate
+
** gallate biosynthesis
−
* molecular weight:
+
−
** 168.144   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-cysteic acid
 
−
** 3-sulfoalanine
 
−
** 2-amino-3-sulfopropionic acid
 
−
** (R)-cysteate
 
−
** 3-sulfo-L-alanine
 
−
** (2R)-2-amino-3-sulfopropanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
−
* [[RXN-11737]]
+
** 4 associated gene(s):
 +
*** [[Ec-07_000550]]
 +
*** [[Ec-26_004120]]
 +
*** [[Ec-14_005400]]
 +
*** [[Ec-02_006010]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12131 RXN-12131]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12132 RXN-12132]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140381 7140381]
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB02757
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=gallate biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00506 C00506]
+
{{#set: reaction found=1}}
−
* CHEMSPIDER:
+
{{#set: total reaction=3}}
−
** [http://www.chemspider.com/Chemical-Structure.5482600.html 5482600]
+
{{#set: completion rate=33.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58090 58090]
+
−
* METABOLIGHTS : MTBLC58090
+
−
{{#set: smiles=C(C([N+])C(=O)[O-])S(=O)(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M}}
+
−
{{#set: common name=L-cysteate}}
+
−
{{#set: molecular weight=168.144    }}
+
−
{{#set: common name=L-cysteic acid|3-sulfoalanine|2-amino-3-sulfopropionic acid|(R)-cysteate|3-sulfo-L-alanine|(2R)-2-amino-3-sulfopropanoic acid}}
+
−
{{#set: reversible reaction associated=RXN-11737}}
+

Latest revision as of 20:01, 21 March 2018

Pathway PWY-6707

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6707&oldid=23924"