Difference between revisions of "PWY-6992"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6992 PWY-6992] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1,5-anhydrofructose degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[MANNPISOM-RXN]] | |
− | * [[ | + | ** 4 associated gene(s): |
− | * [[RXN- | + | *** [[Ec-20_000830]] |
− | == Reaction(s) | + | *** [[Ec-28_000080]] |
− | * [ | + | *** [[Ec-28_000050]] |
+ | *** [[Ec-27_005440]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[PGLUCISOM-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-24_002470]] | ||
+ | *** [[Ec-13_003530]] | ||
+ | *** [[Ec-13_003810]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-13064]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-01_010880]] | ||
+ | *** [[Ec-26_003280]] | ||
+ | *** [[Ec-00_001320]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.292-RXN 1.1.1.292-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN MANNKIN-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=1,5-anhydrofructose degradation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=60.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:06, 21 March 2018
Pathway PWY-6992
- taxonomic range:
- common name:
- 1,5-anhydrofructose degradation
- Synonym(s):
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- MANNPISOM-RXN
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-13064
- 3 associated gene(s):
- 1 reconstruction source(s) associated: