Difference between revisions of "PWY-7185"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7185 PWY-7185] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** 3-hydroxy-5-methylhex-4-enoyl-CoA
+
** UTP and CTP dephosphorylation I
−
* molecular weight:
+
−
** 889.657   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** pyrimidine nucleotides dephosphorylation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-11919]]
+
* [[CTPSYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-20_000910]]
 +
*** [[Ec-00_000570]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN-12199]]
 +
** 1 associated gene(s):
 +
*** [[Ec-02_001970]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-12200]]
 +
** 1 associated gene(s):
 +
*** [[Ec-02_001970]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-14025]]
 +
** 3 associated gene(s):
 +
*** [[Ec-12_005060]]
 +
*** [[Ec-15_000820]]
 +
*** [[Ec-05_000950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-14026]]
 +
** 3 associated gene(s):
 +
*** [[Ec-05_000950]]
 +
*** [[Ec-15_000820]]
 +
*** [[Ec-12_005060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102]
+
{{#set: taxonomic range=TAX-2759}}
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469]
+
{{#set: common name=UTP and CTP dephosphorylation I}}
−
* HMDB : HMDB60373
+
{{#set: common name=pyrimidine nucleotides dephosphorylation}}
−
{{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=5}}
−
{{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}}
+
{{#set: total reaction=5}}
−
{{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}}
+
{{#set: completion rate=100.0}}
−
{{#set: molecular weight=889.657    }}
+
−
{{#set: produced by=RXN-11919}}
+

Latest revision as of 20:33, 21 March 2018

Pathway PWY-7185

  • taxonomic range:
  • common name:
    • UTP and CTP dephosphorylation I
  • Synonym(s):
    • pyrimidine nucleotides dephosphorylation

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7185&oldid=27770"