Difference between revisions of "PWY-7385"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] ==
−
* smiles:
+
* taxonomic range:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N
+
 
* common name:
 
* common name:
−
** maltotriose
+
** 1,3-propanediol biosynthesis (engineered)
−
* molecular weight:
+
−
** 504.441   
+
 
* Synonym(s):
 
* Synonym(s):
−
** amylotriose
+
** 1,3-PDO biosynthesis
−
** α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN0-5183]]
+
'''5''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.8-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-19_001930]]
 +
*** [[Ec-19_004200]]
 +
*** [[Ec-27_006990]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-14_003880]]
 +
*** [[Ec-22_000070]]
 +
*** [[Ec-12_002540]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[F16ALDOLASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-10_004980]]
 +
*** [[Ec-01_008040]]
 +
*** [[Ec-10_000880]]
 +
*** [[Ec-14_001680]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[GLUCOKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_005030]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[PGLUCISOM-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-24_002470]]
 +
*** [[Ec-13_003530]]
 +
*** [[Ec-13_003810]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-DEHYDRATASE-RXN GLYCEROL-DEHYDRATASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14965 RXN-14965]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6487 RXN0-6487]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7077 RXN0-7077]
 
== External links  ==
 
== External links  ==
−
* CAS : 1109-28-0
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439586 439586]
+
{{#set: common name=1,3-propanediol biosynthesis (engineered)}}
−
* HMDB : HMDB01262
+
{{#set: common name=1,3-PDO biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=5}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01835 C01835]
+
{{#set: total reaction=9}}
−
* CHEMSPIDER:
+
{{#set: completion rate=56.0}}
−
** [http://www.chemspider.com/Chemical-Structure.388669.html 388669]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61993 61993]
+
−
* BIGG : malttr
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O}}
+
−
{{#set: inchi key=InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N}}
+
−
{{#set: common name=maltotriose}}
+
−
{{#set: molecular weight=504.441    }}
+
−
{{#set: common name=amylotriose|α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose}}
+
−
{{#set: consumed by=RXN0-5183}}
+

Latest revision as of 20:28, 21 March 2018

Pathway PWY-7385

  • taxonomic range:
  • common name:
    • 1,3-propanediol biosynthesis (engineered)
  • Synonym(s):
    • 1,3-PDO biosynthesis

Reaction(s) found

5 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7385&oldid=27169"