Difference between revisions of "PWY0-1264"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * smiles: ** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264] ==
* smiles:
+
* taxonomic range:
** CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** octoketide
+
** biotin-carboxyl carrier protein assembly
* molecular weight:
+
** 317.274   
+
 
* Synonym(s):
 
* Synonym(s):
** SEK4
+
** BCCP assembly
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
* [[RXN-10734]]
+
* [[BIOTINLIG-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-01_008620]]
 +
*** [[Ec-05_005190]]
 +
*** [[Ec-00_003530]]
 +
*** [[Ec-11_004970]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7101]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-5055]]
 +
** 3 associated gene(s):
 +
*** [[Ec-19_003230]]
 +
*** [[Ec-19_003040]]
 +
*** [[Ec-20_002520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN-CARBOXYL-RXN BIOTIN-CARBOXYL-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237243 44237243]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
{{#set: smiles=CC1(O)(CC(=O)C3(C(O1)=CC(O)=CC(CC2(OC(=O)C=C([O-])C=2))=3))}}
+
* ARACYC:
{{#set: inchi key=InChIKey=WFNZGUNBSCUXFX-UHFFFAOYSA-M}}
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
{{#set: common name=octoketide}}
+
{{#set: taxonomic range=TAX-33090}}
{{#set: molecular weight=317.274    }}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=SEK4}}
+
{{#set: common name=biotin-carboxyl carrier protein assembly}}
{{#set: produced by=RXN-10734}}
+
{{#set: common name=BCCP assembly}}
 +
{{#set: reaction found=3}}
 +
{{#set: total reaction=4}}
 +
{{#set: completion rate=75.0}}

Latest revision as of 20:26, 21 March 2018

Pathway PWY0-1264

  • taxonomic range:
  • common name:
    • biotin-carboxyl carrier protein assembly
  • Synonym(s):
    • BCCP assembly

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links