Difference between revisions of "PWY0-1581"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_003170 == * left end position: ** 3599375 * transcription direction: ** NEGATIVE * right end position: ** 3608112 * centisome position: ** 64.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M |
− | * | + | * common name: |
− | ** | + | ** ent-7α-hydroxykaur-16-en-19-oate |
− | * | + | * molecular weight: |
− | ** | + | ** 317.447 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ent-7-α-hydroxykaurenoate |
− | ** | + | ** ent-7-α-hydroxykaurenoic acid |
+ | ** 7-hydroxy-kaurenoic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN1F-160]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.14.13.79-RXN]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR0104540005 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875] |
+ | {{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}} | ||
+ | {{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}} | ||
+ | {{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}} | ||
+ | {{#set: molecular weight=317.447 }} | ||
+ | {{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}} | ||
+ | {{#set: consumed by=RXN1F-160}} | ||
+ | {{#set: produced by=1.14.13.79-RXN}} |
Revision as of 21:31, 17 March 2018
Contents
Metabolite CPD1F-136
- smiles:
- C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
- inchi key:
- InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
- common name:
- ent-7α-hydroxykaur-16-en-19-oate
- molecular weight:
- 317.447
- Synonym(s):
- ent-7-α-hydroxykaurenoate
- ent-7-α-hydroxykaurenoic acid
- 7-hydroxy-kaurenoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))" cannot be used as a page name in this wiki.