Difference between revisions of "PWY4FS-4"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-4 PWY4FS-4] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-4 PWY4FS-4] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phosphatidylcholine biosynthesis IV |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | * | + | * [[RXN4FS-2]] |
− | * [[ | + | ** 3 associated gene(s): |
− | * [[ | + | *** [[Ec-24_001260]] |
− | * [[ | + | *** [[Ec-08_004940]] |
− | + | *** [[Ec-18_002350]] | |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[annotation-esiliculosus_genome]] |
− | * [ | + | == Reaction(s) not found == |
− | * [ | + | * [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.103-RXN 2.1.1.103-RXN] |
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5642 RXN-5642] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-3 RXN4FS-3] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN4FS-4 RXN4FS-4] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=phosphatidylcholine biosynthesis IV}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:59, 21 March 2018
Pathway PWY4FS-4
- taxonomic range:
- common name:
- phosphatidylcholine biosynthesis IV
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN4FS-2
- 3 associated gene(s):
- 1 reconstruction source(s) associated: