Difference between revisions of "Protein-D-serines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] == * common name: ** a [protein]-D-serine * Synonym(s): =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
+
* inchi key:
+
** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
+
 
* common name:
 
* common name:
** 5α-cholesta-7,24-dien-3β-ol
+
** a [protein]-D-serine
* molecular weight:
+
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11887]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[5.1.1.16-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-D-serine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827]
+
{{#set: reversible reaction associated=5.1.1.16-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439]
+
* HMDB : HMDB06842
+
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}}
+
{{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}}
+
{{#set: common name=5α-cholesta-7,24-dien-3β-ol}}
+
{{#set: molecular weight=384.644    }}
+
{{#set: consumed by=RXN-11887}}
+

Latest revision as of 20:50, 21 March 2018

Metabolite Protein-D-serines

  • common name:
    • a [protein]-D-serine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-D-serine" cannot be used as a page name in this wiki.