Difference between revisions of "R07063"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=GZCGUP...") |
(Created page with "Category:Gene == Gene Ec-19_004010 == * left end position: ** 4354332 * transcription direction: ** NEGATIVE * right end position: ** 4366157 * centisome position: ** 72.9...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Ec-19_004010 == |
| − | * | + | * left end position: |
| − | ** | + | ** 4354332 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 4366157 |
| − | * | + | * centisome position: |
| − | ** | + | ** 72.92848 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Esi_0088_0081 | ||
| + | ** Esi0088_0081 | ||
| + | ** NADPH oxidase | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * [[RXN-10745]] |
| − | + | ** esiliculosus_genome | |
| − | == | + | ***ec-number |
| − | + | == Pathways associated == | |
== External links == | == External links == | ||
| − | + | {{#set: left end position=4354332}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=4366157}} | |
| − | + | {{#set: centisome position=72.92848 }} | |
| − | {{#set: | + | {{#set: common name=Esi_0088_0081|Esi0088_0081|NADPH oxidase}} |
| − | {{#set: | + | {{#set: reaction associated=RXN-10745}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 22:31, 17 March 2018
Gene Ec-19_004010
- left end position:
- 4354332
- transcription direction:
- NEGATIVE
- right end position:
- 4366157
- centisome position:
- 72.92848
- Synonym(s):
- Esi_0088_0081
- Esi0088_0081
- NADPH oxidase
Reactions associated
- RXN-10745
- esiliculosus_genome
- ec-number
- esiliculosus_genome
