Difference between revisions of "RXN-11058"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIS-ACONITATE HOMO-CIS-ACONITATE] == * smiles: ** C(=O)([O-])C=C(CCC([O-])=O)C(=O)[O-] * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11058 RXN-11058] == * direction: ** LEFT-TO-RIGHT * common name: ** P-loop containing nucleosid...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11058 RXN-11058] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** P-loop containing nucleoside triphosphate hydrolase |
− | * | + | ** Aryl sulfotransferase |
− | ** | + | ** Sulfotransferase domain |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[PAPS]][c] '''+''' 1 [[CPD-12014]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-12015]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 6-hydroxymelatonin[c] '''=>''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 6-sulfatoxymelatonin[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-06_007320]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_007310]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-00_005410]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-06_007300]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-26_003630]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6398]], melatonin degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=P-loop containing nucleoside triphosphate hydrolase}} | |
− | + | {{#set: common name=Aryl sulfotransferase}} | |
− | + | {{#set: common name=Sulfotransferase domain}} | |
− | + | {{#set: ec number=EC-2.8.2.1}} | |
− | + | {{#set: gene associated=Ec-06_007320|Ec-06_007310|Ec-00_005410|Ec-06_007300|Ec-26_003630}} | |
− | + | {{#set: in pathway=PWY-6398}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:39, 21 March 2018
Contents
Reaction RXN-11058
- direction:
- LEFT-TO-RIGHT
- common name:
- P-loop containing nucleoside triphosphate hydrolase
- Aryl sulfotransferase
- Sulfotransferase domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 3'-phosphoadenylyl-sulfate[c] + 1 6-hydroxymelatonin[c] => 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c] + 1 6-sulfatoxymelatonin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-06_007320
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_007310
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-00_005410
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-06_007300
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-26_003630
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome