Difference between revisions of "RXN-13426"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13426 RXN-13426] == * direction: ** LEFT-TO-RIGHT * common name: ** α-linolenoyl-CoA &Del...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13426 RXN-13426] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
 
* common name:
 
* common name:
−
** dIDP
+
** α-linolenoyl-CoA Δ6-desaturase
−
* molecular weight:
+
** Cytochrome b5-like heme/steroid binding domain
−
** 409.165   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.14.19.3 EC-1.14.19.3]
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyinosine diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 2 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[LINOLENOYL-COA]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[CPD-14392]][c]
−
* [[RXN-14228]]
+
* With common name(s):
 +
** 2 H+[c] '''+''' 1 oxygen[c] '''+''' 1 α-linolenoyl-CoA[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] '''+''' 1 stearidonoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-24_002300]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7049]], icosapentaenoate biosynthesis II (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7049 PWY-7049]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: common name=α-linolenoyl-CoA Δ6-desaturase}}
−
* CHEBI:
+
{{#set: common name=Cytochrome b5-like heme/steroid binding domain}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: ec number=EC-1.14.19.3}}
−
* BIGG : 37395
+
{{#set: gene associated=Ec-24_002300}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-7049}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB03536
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
−
{{#set: common name=dIDP}}
+
−
{{#set: molecular weight=409.165    }}
+
−
{{#set: common name=deoxyinosine diphosphate}}
+
−
{{#set: consumed or produced by=RXN-14228}}
+

Latest revision as of 20:39, 21 March 2018

Reaction RXN-13426

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • α-linolenoyl-CoA Δ6-desaturase
    • Cytochrome b5-like heme/steroid binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7049, icosapentaenoate biosynthesis II (6-desaturase, mammals): PWY-7049
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-13426&oldid=28449"