Difference between revisions of "RXN-14549"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * smiles: ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14549 RXN-14549] == * direction: ** LEFT-TO-RIGHT * common name: ** 25S rRNA (adenine(2142)-N(1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14549 RXN-14549] ==
−
* smiles:
+
* direction:
−
** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
+
 
* common name:
 
* common name:
−
** (E)-2-methylcrotonoyl-CoA
+
** 25S rRNA (adenine(2142)-N(1))-methyltransferase, Bmt2
−
* molecular weight:
+
* ec number:
−
** 845.604   
+
** [http://enzyme.expasy.org/EC/2.1.1.286 EC-2.1.1.286]
 
* Synonym(s):
 
* Synonym(s):
−
** methylcrotonyl-CoA
 
−
** trans-2-methylbut-2-enoyl-CoA
 
−
** 2-methylbut-2-enoyl-CoA
 
−
** tigloyl-CoA
 
−
** tiglyl-CoA
 
−
** 2-methyl-crotonyl-CoA
 
−
** (E)-2-methylbut-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[25S-rRNA-adenine-2142]][c] '''=>''' 1 [[25S-rRNA-N1-methyladenine-2142]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* With common name(s):
−
* [[RXN-14266]]
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 adenine2142 in 25S rRNA[c] '''=>''' 1 N1-methyladenine2142 in 25S rRNA[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c]
−
* [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-12_001780]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6247-62-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=25S rRNA (adenine(2142)-N(1))-methyltransferase, Bmt2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266534 45266534]
+
{{#set: ec number=EC-2.1.1.286}}
−
* CHEBI:
+
{{#set: gene associated=Ec-12_001780}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15478 15478]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03345 C03345]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* HMDB : HMDB02054
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J}}
+
−
{{#set: common name=(E)-2-methylcrotonoyl-CoA}}
+
−
{{#set: molecular weight=845.604    }}
+
−
{{#set: common name=methylcrotonyl-CoA|trans-2-methylbut-2-enoyl-CoA|2-methylbut-2-enoyl-CoA|tigloyl-CoA|tiglyl-CoA|2-methyl-crotonyl-CoA|(E)-2-methylbut-2-enoyl-CoA}}
+
−
{{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|RXN-14266|2-METHYLACYL-COA-DEHYDROGENASE-RXN}}
+

Latest revision as of 20:47, 21 March 2018

Reaction RXN-14549

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 25S rRNA (adenine(2142)-N(1))-methyltransferase, Bmt2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14549&oldid=29332"