Difference between revisions of "RXN-16389"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-15_000020 == * left end position: ** 30505 * transcription direction: ** POSITIVE * right end position: ** 34716 * centisome position: ** 0.565090...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_000020 == |
− | * | + | * left end position: |
− | ** | + | ** 30505 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 34716 |
− | * | + | * centisome position: |
− | ** | + | ** 0.56509024 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0012_0192 |
+ | ** Esi0012_0192 | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-12086]] | |
− | * [[RXN- | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | * [[RXN-12579]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[TRIACYLGLYCEROL-LIPASE-RXN]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[LIPAS-PWY]] | ||
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=30505}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=34716}} | |
− | + | {{#set: centisome position=0.56509024 }} | |
− | + | {{#set: common name=Esi_0012_0192|Esi0012_0192}} | |
− | + | {{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}} | |
− | + | {{#set: pathway associated=LIPAS-PWY|PWY-6857}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:43, 17 March 2018
Gene Ec-15_000020
- left end position:
- 30505
- transcription direction:
- POSITIVE
- right end position:
- 34716
- centisome position:
- 0.56509024
- Synonym(s):
- Esi_0012_0192
- Esi0012_0192
Reactions associated
- RXN-12086
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-12579
- esiliculosus_genome
- go-term
- esiliculosus_genome
- TRIACYLGLYCEROL-LIPASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome