Difference between revisions of "RXN-8040"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-09_002410 == * Synonym(s): ** Esi_0337_0029 ** Esi0337_0029 == Reactions associated == * DIAMINOPIMDECARB-RXN ** pantograph-aragem ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17388 CPD-17388] == |
| + | * smiles: | ||
| + | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J | ||
| + | * common name: | ||
| + | ** 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1116.018 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16137]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-16136]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581251 71581251] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74304 74304] | ||
| + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J}} | ||
| + | {{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}} | ||
| + | {{#set: molecular weight=1116.018 }} | ||
| + | {{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-16137}} | ||
| + | {{#set: produced by=RXN-16136}} | ||
Revision as of 14:48, 21 March 2018
Contents
Metabolite CPD-17388
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=DNHDPAXPQGYGIJ-KWFBMMABSA-J
- common name:
- 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
- molecular weight:
- 1116.018
- Synonym(s):
- 3-oxo-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
