Difference between revisions of "RXN1F-150"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cerebrosides Cerebrosides] == * common name: ** a cerebroside * Synonym(s): ** a monoglycosylce...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cerebrosides Cerebrosides] ==
* smiles:
+
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(9Z)-octadecenoyl-CoA
+
** a cerebroside
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-18:1-Δ9-CoA
+
** a monoglycosylceramide
** 3-oxo-9-cis-octadecenoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17777]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=a cerebroside}}
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
+
{{#set: common name=a monoglycosylceramide}}
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
+
{{#set: reversible reaction associated=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN}}
{{#set: molecular weight=1041.936    }}
+
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
+
{{#set: produced by=RXN-17777}}
+

Revision as of 21:55, 17 March 2018

Metabolite Cerebrosides

  • common name:
    • a cerebroside
  • Synonym(s):
    • a monoglycosylceramide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links