Difference between revisions of "RXN1G-469"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-469 RXN1G-469] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxobehenoyl-[acyl-carrier...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-469 RXN1G-469] ==
−
* smiles:
+
* direction:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
+
 
* common name:
 
* common name:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
+
** 3-oxobehenoyl-[acyl-carrier protein] reductase
−
* molecular weight:
+
** NAD(P)-binding domain
−
** 572.278   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
−
** iPTP
 
−
** isopentenyladenosine riboside-5'-triphosphate
 
−
** iPRTP
 
−
** isopentenyladenosine-5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-4303]]
+
** 1 [[NADPH]][c] '''+''' 1 [[3-oxo-behenoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[R-3-hydroxybehenoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 a 3-oxo-behenoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxybehenoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_007100]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''30''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
+
{{#set: common name=3-oxobehenoyl-[acyl-carrier protein] reductase}}
−
* CHEBI:
+
{{#set: common name=NAD(P)-binding domain}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
+
{{#set: ec number=EC-1.1.1.100}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-01_007100}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
+
{{#set: in pathway=PWYG-321}}
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=572.278    }}
+
−
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
+
−
{{#set: produced by=RXN-4303}}
+

Latest revision as of 20:50, 21 March 2018

Reaction RXN1G-469

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxobehenoyl-[acyl-carrier protein] reductase
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 30 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"3-oxobehenoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-469&oldid=29695"