Difference between revisions of "Ribonucleoside-Diphosphates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * smiles: ** C1([N+]C(C(=O)[O-])CC(O)1) * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apo-FeS-cluster-proteins Apo-FeS-cluster-proteins] == * common name: ** an apo-iron-sulfur prot...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Apo-FeS-cluster-proteins Apo-FeS-cluster-proteins] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an apo-iron-sulfur protein |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14390]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an apo-iron-sulfur protein}} | |
| − | + | {{#set: consumed by=RXN-14390}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 23:07, 17 March 2018
Contents
Metabolite Apo-FeS-cluster-proteins
- common name:
- an apo-iron-sulfur protein
- Synonym(s):
