Difference between revisions of "SERINE-O-ACETTRAN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONO-1-4-LACTONE L-GULONO-1-4-LACTONE] == * smiles: ** C(C([CH]1(C(C(C(O1)=O)O)O))O)O * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SERINE-O-ACETTRAN-RXN SERINE-O-ACETTRAN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Bac...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SERINE-O-ACETTRAN-RXN SERINE-O-ACETTRAN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Bacterial transferase hexapeptide repeat |
− | * | + | ** Trimeric LpxA-like |
− | ** | + | ** Serine acetyltransferase, N-terminal |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.30 EC-2.3.1.30] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ACETYL-COA]][c] '''+''' 1 [[SER]][c] '''=>''' 1 [[ACETYLSERINE]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
+ | ** 1 acetyl-CoA[c] '''+''' 1 L-serine[c] '''=>''' 1 O-acetyl-L-serine[c] '''+''' 1 coenzyme A[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-22_002810]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-00_004310]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-24_003520]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-01_001610]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[CYSTSYN-PWY]], L-cysteine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=CYSTSYN-PWY CYSTSYN-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-7274]], D-cycloserine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7274 PWY-7274] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6936]], seleno-amino acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24560 24560] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00586 R00586] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q39533 Q39533] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q06750 Q06750] |
− | * | + | ** [http://www.uniprot.org/uniprot/P71405 P71405] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JR86 Q9JR86] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PPF6 Q9PPF6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P23145 P23145] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CEI8 Q9CEI8] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P43886 P43886] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32003 P32003] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P29847 P29847] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q42588 Q42588] |
+ | ** [http://www.uniprot.org/uniprot/Q39218 Q39218] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42538 Q42538] | ||
+ | ** [http://www.uniprot.org/uniprot/P74089 P74089] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8W2B8 Q8W2B8] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8S895 Q8S895] | ||
+ | ** [http://www.uniprot.org/uniprot/P93544 P93544] | ||
+ | ** [http://www.uniprot.org/uniprot/O69218 O69218] | ||
+ | ** [http://www.uniprot.org/uniprot/O32979 O32979] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A9D4 P0A9D4] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=Bacterial transferase hexapeptide repeat}} | ||
+ | {{#set: common name=Trimeric LpxA-like}} | ||
+ | {{#set: common name=Serine acetyltransferase, N-terminal}} | ||
+ | {{#set: ec number=EC-2.3.1.30}} | ||
+ | {{#set: gene associated=Ec-22_002810|Ec-00_004310|Ec-24_003520|Ec-01_001610}} | ||
+ | {{#set: in pathway=CYSTSYN-PWY|PWY-7274|PWY-6936}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:27, 21 March 2018
Contents
Reaction SERINE-O-ACETTRAN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Bacterial transferase hexapeptide repeat
- Trimeric LpxA-like
- Serine acetyltransferase, N-terminal
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACETYL-COA[c] + 1 SER[c] => 1 ACETYLSERINE[c] + 1 CO-A[c]
- With common name(s):
- 1 acetyl-CoA[c] + 1 L-serine[c] => 1 O-acetyl-L-serine[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-22_002810
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-00_004310
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-24_003520
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-01_001610
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
- CYSTSYN-PWY, L-cysteine biosynthesis I: CYSTSYN-PWY
- 2 reactions found over 2 reactions in the full pathway
- PWY-7274, D-cycloserine biosynthesis: PWY-7274
- 1 reactions found over 6 reactions in the full pathway
- PWY-6936, seleno-amino acid biosynthesis: PWY-6936
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: