Difference between revisions of "Saturated-2-Lysophosphatidates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-2-Lysophosphatidates Saturated-2-Lysophosphatidates] == * common name: ** a 2,3,4-sat...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-2-Lysophosphatidates Saturated-2-Lysophosphatidates] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 2,3,4-saturated 2-lysophosphatidate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-acyl-sn-glycerol 3-phosphate |
− | + | ** acyl-sn-glycerol-3P | |
− | ** | + | ** acyl-sn-glycerol 3-phosphate |
− | ** | + | ** a 1-acyl-sn-glycero 3-phosphate |
− | ** | + | ** an acyl-sn-glycerol-3P |
− | ** glycerol | + | ** an acyl-sn-glycerol 3-phosphate |
− | ** | + | ** a 1-acyl-sn-glycerol-3P |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5514]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 2,3,4-saturated 2-lysophosphatidate}} | |
− | + | {{#set: common name=1-acyl-sn-glycerol 3-phosphate|acyl-sn-glycerol-3P|acyl-sn-glycerol 3-phosphate|a 1-acyl-sn-glycero 3-phosphate|an acyl-sn-glycerol-3P|an acyl-sn-glycerol 3-phosphate|a 1-acyl-sn-glycerol-3P}} | |
− | + | {{#set: consumed by=RXN0-5514}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by= | + |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite Saturated-2-Lysophosphatidates
- common name:
- a 2,3,4-saturated 2-lysophosphatidate
- Synonym(s):
- 1-acyl-sn-glycerol 3-phosphate
- acyl-sn-glycerol-3P
- acyl-sn-glycerol 3-phosphate
- a 1-acyl-sn-glycero 3-phosphate
- an acyl-sn-glycerol-3P
- an acyl-sn-glycerol 3-phosphate
- a 1-acyl-sn-glycerol-3P