Difference between revisions of "Saturated-2-Lysophosphatidates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] == * smiles: ** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O * inchi key: ** InChIKey=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-2-Lysophosphatidates Saturated-2-Lysophosphatidates] == * common name: ** a 2,3,4-sat...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13014 CPD-13014] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-2-Lysophosphatidates Saturated-2-Lysophosphatidates] ==
−
* smiles:
+
−
** CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O
+
−
* inchi key:
+
−
** InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** tributyrin
+
** a 2,3,4-saturated 2-lysophosphatidate
−
* molecular weight:
+
−
** 302.367   
+
 
* Synonym(s):
 
* Synonym(s):
−
** butyryl triglyceride
+
** 1-acyl-sn-glycerol 3-phosphate
−
** butanoic acid, 1,2,3-propanetriyl ester
+
** acyl-sn-glycerol-3P
−
** 1,2,3-tributyrylglycerol
+
** acyl-sn-glycerol 3-phosphate
−
** tributin
+
** a 1-acyl-sn-glycero 3-phosphate
−
** tributyrinine
+
** an acyl-sn-glycerol-3P
−
** glycerol tributyrate
+
** an acyl-sn-glycerol 3-phosphate
−
** glyceryl tributyrate
+
** a 1-acyl-sn-glycerol-3P
−
** butyrin
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12086]]
+
* [[RXN0-5514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a 2,3,4-saturated 2-lysophosphatidate}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13870 C13870]
+
{{#set: common name=1-acyl-sn-glycerol 3-phosphate|acyl-sn-glycerol-3P|acyl-sn-glycerol 3-phosphate|a 1-acyl-sn-glycero 3-phosphate|an acyl-sn-glycerol-3P|an acyl-sn-glycerol 3-phosphate|a 1-acyl-sn-glycerol-3P}}
−
* CHEMSPIDER:
+
{{#set: consumed by=RXN0-5514}}
−
** [http://www.chemspider.com/Chemical-Structure.13849665.html 13849665]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35020 35020]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6050 6050]
+
−
* HMDB : HMDB31094
+
−
{{#set: smiles=CCCC(OCC(OC(CCC)=O)COC(CCC)=O)=O}}
+
−
{{#set: inchi key=InChIKey=UYXTWWCETRIEDR-UHFFFAOYSA-N}}
+
−
{{#set: common name=tributyrin}}
+
−
{{#set: molecular weight=302.367    }}
+
−
{{#set: common name=butyryl triglyceride|butanoic acid, 1,2,3-propanetriyl ester|1,2,3-tributyrylglycerol|tributin|tributyrinine|glycerol tributyrate|glyceryl tributyrate|butyrin}}
+
−
{{#set: consumed by=RXN-12086}}
+

Latest revision as of 20:59, 21 March 2018

Metabolite Saturated-2-Lysophosphatidates

  • common name:
    • a 2,3,4-saturated 2-lysophosphatidate
  • Synonym(s):
    • 1-acyl-sn-glycerol 3-phosphate
    • acyl-sn-glycerol-3P
    • acyl-sn-glycerol 3-phosphate
    • a 1-acyl-sn-glycero 3-phosphate
    • an acyl-sn-glycerol-3P
    • an acyl-sn-glycerol 3-phosphate
    • a 1-acyl-sn-glycerol-3P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Saturated-2-Lysophosphatidates&oldid=30738"