Difference between revisions of "TransportSeed COB-I-ALAMIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5084 PWY-5084] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5084 PWY-5084] ==
−
* smiles:
+
* taxonomic range:
−
** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
−
** amino-parathion
+
** 2-oxoglutarate decarboxylation to succinyl-CoA
−
* molecular weight:
+
−
** 261.275   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-oxoglutarate dehydrogenase complex
 +
** 2-ketoglutarate dehydrogenase complex
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2OXOGLUTDECARB-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-25_000020]]
 +
*** [[Ec-21_002310]]
 +
*** [[Ec-21_002300]]
 +
*** [[Ec-27_004160]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7716]]
 +
** 3 associated gene(s):
 +
*** [[Ec-21_002300]]
 +
*** [[Ec-27_004160]]
 +
*** [[Ec-25_000020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-1147]]
 +
** 3 associated gene(s):
 +
*** [[Ec-25_000020]]
 +
*** [[Ec-21_002300]]
 +
*** [[Ec-27_004160]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=220 220]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5084 PWY-5084]
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06605 C06605]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB01504
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)N))(OCC)=S}}
+
{{#set: common name=2-oxoglutarate decarboxylation to succinyl-CoA}}
−
{{#set: inchi key=InChIKey=XIZOTXGJXSTQDI-UHFFFAOYSA-N}}
+
{{#set: common name=2-oxoglutarate dehydrogenase complex|2-ketoglutarate dehydrogenase complex}}
−
{{#set: common name=amino-parathion}}
+
{{#set: reaction found=3}}
−
{{#set: molecular weight=261.275    }}
+
{{#set: total reaction=3}}
−
{{#set: consumed by=AMINOPARATHION-PHOSPHATASE-RXN}}
+
{{#set: completion rate=100.0}}

Revision as of 14:36, 21 March 2018

Pathway PWY-5084

  • taxonomic range:
  • common name:
    • 2-oxoglutarate decarboxylation to succinyl-CoA
  • Synonym(s):
    • 2-oxoglutarate dehydrogenase complex
    • 2-ketoglutarate dehydrogenase complex

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=TransportSeed_COB-I-ALAMIN&oldid=20067"