Difference between revisions of "TransportSeed CPD-3"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_006350 == * left end position: ** 6446425 * transcription direction: ** POSITIVE * right end position: ** 6447282 * centisome position: ** 98.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == |
− | * | + | * smiles: |
− | ** | + | ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N |
− | * | + | * common name: |
− | ** | + | ** 7-methylurate |
− | * | + | * molecular weight: |
− | ** | + | ** 182.138 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-methyluric acid |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11521]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.62375.html 62375] |
− | {{#set: common name= | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470] | |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355] | ||
+ | * HMDB : HMDB11107 | ||
+ | {{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}} | ||
+ | {{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=7-methylurate}} | ||
+ | {{#set: molecular weight=182.138 }} | ||
+ | {{#set: common name=7-methyluric acid}} | ||
+ | {{#set: produced by=RXN-11521}} |
Revision as of 23:00, 17 March 2018
Contents
Metabolite CPD-12481
- smiles:
- CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
- inchi key:
- InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
- common name:
- 7-methylurate
- molecular weight:
- 182.138
- Synonym(s):
- 7-methyluric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links