Difference between revisions of "TransportSeed NA+"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHURENATE XANTHURENATE] == * smiles: ** C1(=CC2(=C(C(O)=C1)N=C(C=C([O-])2)C(=O)[O-])) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_NA+ TransportSeed_NA+] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Fo...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_NA+ TransportSeed_NA+] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[NA+]][e] '''=>''' 1.0 [[NA+]][c] |
− | + | * With common name(s): | |
+ | ** 1.0 Na+[e] '''=>''' 1.0 Na+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-import_from_medium]] | ||
+ | *** Comment: [[added to manage seeds from extracellular to cytosol compartment]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=manual-import_from_medium}} | |
− | + | {{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:37, 21 March 2018
Contents
Reaction TransportSeed_NA+
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual