Difference between revisions of "Xyloglucans-Galactose-23"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] == * common name: ** an XLLG xylogulcan * Sy...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Xyloglucans-Galactose-23 Xyloglucans-Galactose-23] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
+
 
* common name:
 
* common name:
** Mg-protoporphyrin
+
** an XLLG xylogulcan
* molecular weight:
+
** 582.94   
+
 
* Synonym(s):
 
* Synonym(s):
** Mg-protoporphyrin IX
+
** a xyloglucan with galactose side chain at positions 2 and 3
** magnesium protoporphyrin
+
** MgP
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
* [[RXN-9463]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-20]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an XLLG xylogulcan}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481]
+
{{#set: common name=a xyloglucan with galactose side chain at positions 2 and 3}}
* CHEBI:
+
{{#set: consumed by=RXN-9463}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}}
+
{{#set: common name=Mg-protoporphyrin}}
+
{{#set: molecular weight=582.94    }}
+
{{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}}
+
{{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
+
{{#set: produced by=RXN1F-20}}
+

Latest revision as of 20:59, 21 March 2018

Metabolite Xyloglucans-Galactose-23

  • common name:
    • an XLLG xylogulcan
  • Synonym(s):
    • a xyloglucan with galactose side chain at positions 2 and 3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links