Difference between revisions of "2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] == * smiles: *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)C(C([O-])=O)C(C([O-])=O)O | ** CC(C)C(C([O-])=O)C(C([O-])=O)O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 174.153 | ** 174.153 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RNQHMTFBUSSBJQ-CRCLSJGQSA-L | ||
+ | * common name: | ||
+ | ** (2R,3S)-3-isopropylmalate | ||
* Synonym(s): | * Synonym(s): | ||
** 2-D-threo-hydroxy-3-carboxy-isocaproate | ** 2-D-threo-hydroxy-3-carboxy-isocaproate | ||
Line 16: | Line 16: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[IMDH]] | * [[IMDH]] | ||
+ | * [[RXN-13158]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[IMDHT_LPAREN_3c2hmp_RPAREN_]] | * [[IMDHT_LPAREN_3c2hmp_RPAREN_]] | ||
* [[RXN-13163]] | * [[RXN-13163]] | ||
* [[3-ISOPROPYLMALDEHYDROG-RXN]] | * [[3-ISOPROPYLMALDEHYDROG-RXN]] | ||
+ | * [[RXN-8991]] | ||
== External links == | == External links == | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5256741.html 5256741] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857402 6857402] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857402 6857402] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35121 35121] | ||
* HMDB : HMDB12156 | * HMDB : HMDB12156 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04411 C04411] | ** [http://www.genome.jp/dbget-bin/www_bget?C04411 C04411] | ||
− | |||
− | |||
− | |||
− | |||
* BIGG : 3c2hmp | * BIGG : 3c2hmp | ||
{{#set: smiles=CC(C)C(C([O-])=O)C(C([O-])=O)O}} | {{#set: smiles=CC(C)C(C([O-])=O)C(C([O-])=O)O}} | ||
− | |||
− | |||
{{#set: molecular weight=174.153 }} | {{#set: molecular weight=174.153 }} | ||
+ | {{#set: inchi key=InChIKey=RNQHMTFBUSSBJQ-CRCLSJGQSA-L}} | ||
+ | {{#set: common name=(2R,3S)-3-isopropylmalate}} | ||
{{#set: common name=2-D-threo-hydroxy-3-carboxy-isocaproate|3-carboxy-2-hydroxy-4-methylpentanoate|β-isopropylmalate|3-isopropylmalate}} | {{#set: common name=2-D-threo-hydroxy-3-carboxy-isocaproate|3-carboxy-2-hydroxy-4-methylpentanoate|β-isopropylmalate|3-isopropylmalate}} | ||
− | {{#set: consumed by=RXN-13158 | + | {{#set: consumed by=IMDH|RXN-13158}} |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=IMDHT_LPAREN_3c2hmp_RPAREN_|RXN-13163|3-ISOPROPYLMALDEHYDROG-RXN|RXN-8991}} |
Latest revision as of 12:29, 10 January 2019
Contents
Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE
- smiles:
- CC(C)C(C([O-])=O)C(C([O-])=O)O
- molecular weight:
- 174.153
- inchi key:
- InChIKey=RNQHMTFBUSSBJQ-CRCLSJGQSA-L
- common name:
- (2R,3S)-3-isopropylmalate
- Synonym(s):
- 2-D-threo-hydroxy-3-carboxy-isocaproate
- 3-carboxy-2-hydroxy-4-methylpentanoate
- β-isopropylmalate
- 3-isopropylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.