Difference between revisions of "ASPARTATE-DEG1-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPAIF FPAIF] == * direction: ** REVERSIBLE * common name: ** phosphoribosylaminoimidazolecarboxamid...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPAIF FPAIF] ==
* smiles:
+
* direction:
** COC1(=C(O)C=CC(C(O)C=O)=C1)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
+
 
* common name:
 
* common name:
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** phosphoribosylaminoimidazolecarboxamide formyltransferase
* molecular weight:
+
** 182.176   
+
 
* Synonym(s):
 
* Synonym(s):
** MOPEGAL
 
** 4-hydroxy-3-methoxymandelaldehyde
 
** 3-methoxy 4-hydroxy mandelic aldehyde
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[AICAR]][c] '''+''' 1.0 [[10-FORMYL-THF]][c] '''<=>''' 1.0 [[THF]][c] '''+''' 1.0 [[PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE]][c]
* [[RXN-10915]]
+
* With common name(s):
 +
** 1.0 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c] '''+''' 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] '''<=>''' 1.0 tetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 5-formamido-1-(5-phospho-D-ribosyl)-imidazole-4-carboxamide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18420]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114]
+
{{#set: common name=phosphoribosylaminoimidazolecarboxamide formyltransferase}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_18420}}
** [http://www.chemspider.com/Chemical-Structure.389601.html 389601]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583]
+
{{#set: reconstruction tool=pantograph}}
* HMDB : HMDB04061
+
{{#set: reconstruction source=creinhardtii}}
{{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}}
+
{{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}}
+
{{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
{{#set: molecular weight=182.176    }}
+
{{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}}
+
{{#set: consumed or produced by=RXN-10915}}
+

Revision as of 15:41, 10 January 2018

Reaction FPAIF

  • direction:
    • REVERSIBLE
  • common name:
    • phosphoribosylaminoimidazolecarboxamide formyltransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c] + 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] <=> 1.0 tetrahydropteroyl mono-L-glutamate[c] + 1.0 5-formamido-1-(5-phospho-D-ribosyl)-imidazole-4-carboxamide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links