Difference between revisions of "ALPHA-RIBAZOLE-5-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13193 RXN-13193] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13193 RXN-13193] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
+
** [http://enzyme.expasy.org/EC/1.14.15.n EC-1.14.15.n]
−
* common name:
+
−
** gibberellin A15 (open lactone form)
+
−
* molecular weight:
+
−
** 346.422   
+
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin A15
 
−
** GA15
 
−
** GA15 (open lactone form)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN1F-163]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 4 [[Reduced-ferredoxins]][c] '''+''' 2 [[OXYGEN-MOLECULE]][c] '''+''' 4 [[PROTON]][c] '''+''' 1 [[CPD1F-130]][c] '''=>''' 2 [[WATER]][c] '''+''' 4 [[Oxidized-ferredoxins]][c] '''+''' 1 [[CPD1F-133]][c]
−
* [[RXN1F-162]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 4 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 2 oxygen[c] '''+''' 4 H+[c] '''+''' 1 zeaxanthin[c] '''=>''' 2 H2O[c] '''+''' 4 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 violaxanthin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10919]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170017
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14944 14944]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14940 14940]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
+
{{#set: ec number=EC-1.14.15.n}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_10919}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
+
{{#set: in pathway=}}
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=gibberellin A15 (open lactone form)}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: molecular weight=346.422    }}
+
−
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
+
−
{{#set: consumed by=RXN1F-163}}
+
−
{{#set: produced by=RXN1F-162}}
+

Revision as of 16:42, 10 January 2018

Reaction RXN-13193

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ALPHA-RIBAZOLE-5-P&oldid=10076"