Difference between revisions of "Tiso gene 19650"

Revision as of 15:42, 10 January 2018

"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_19650 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
-* left end position:
+* smiles:
-** 1900
+** CC([CH]=O)C(=O)[O-]
-* transcription direction:
+* inchi key:
-** POSITIVE
+** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
-* right end position:
+* common name:
-** 2014
+** (R)-methylmalonate-semialdehyde
-* centisome position:
+* molecular weight:
-** 88.743576
+** 101.082
 * Synonym(s):
+** (R)-2-methyl-3-oxopropanoate
+** (R)-ch3-malonate-semialdehyde
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[3.1.1.47-RXN]]
+== Reaction(s) known to produce the compound ==
-** in-silico_annotation
+== Reaction(s) of unknown directionality ==
-***ec-number
+* [[RXN-14056]]
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=1900}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
-{{#set: right end position=2014}}
+{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
-{{#set: centisome position=88.743576    }}
+{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
-{{#set: reaction associated=3.1.1.47-RXN}}
+{{#set: common name=(R)-methylmalonate-semialdehyde}}
+{{#set: molecular weight=101.082    }}
+{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+{{#set: consumed or produced by=RXN-14056}}