Difference between revisions of "PWY0-1581"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7299 PWY-7299] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-131 CPD1F-131] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7299 PWY-7299] ==
* smiles:
+
* taxonomic range:
** CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
* inchi key:
+
** InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N
+
 
* common name:
 
* common name:
** antheraxanthin
+
** progesterone biosynthesis
* molecular weight:
+
** 584.881   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7985]]
+
* '''1''' reaction(s) found
* [[RXN-7979]]
+
** [[RXN66-353]]
* [[ANXANor]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* '''1''' reaction(s) not found
* [[RXN-7978]]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN66-354 RXN66-354]
* [[RXN-7984]]
+
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33208}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244322 25244322]
+
{{#set: common name=progesterone biosynthesis}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27867 27867]
+
{{#set: reaction not found=1}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C08579 C08579]
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC12(C(CC(CC1(C)O2)O)(C)C))C)C)C=CC=C(C=CC3(=C(CC(CC3(C)C)O)C))C}}
+
{{#set: inchi key=InChIKey=OFNSUWBAQRCHAV-UKGDUWIJSA-N}}
+
{{#set: common name=antheraxanthin}}
+
{{#set: molecular weight=584.881    }}
+
{{#set: consumed by=RXN-7985|RXN-7979|ANXANor}}
+
{{#set: produced by=RXN-7978|RXN-7984}}
+

Revision as of 15:42, 10 January 2018

Pathway PWY-7299

  • taxonomic range:
  • common name:
    • progesterone biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links