Difference between revisions of "Tiso gene 5462"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16094 RXN-16094] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16094 RXN-16094] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=CC1(=CC=C(O)C=C1))CO
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199]
+
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
 +
* common name:
 +
** 4-coumaryl alcohol
 +
* molecular weight:
 +
** 150.177   
 
* Synonym(s):
 
* Synonym(s):
 +
** p-coumaryl alcohol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-18]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-17346]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN-1102]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 linoleoyl-CoA[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7601]], arachidonate biosynthesis IV (8-detaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7601 PWY-7601]
+
−
** '''7''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7725]], arachidonate biosynthesis V (8-detaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7725 PWY-7725]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6598]], sciadonate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6598 PWY-6598]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.199}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
−
{{#set: in pathway=PWY-7601|PWY-7725|PWY-6598}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
 +
* HMDB : HMDB03654
 +
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
 +
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
 +
{{#set: common name=4-coumaryl alcohol}}
 +
{{#set: molecular weight=150.177    }}
 +
{{#set: common name=p-coumaryl alcohol}}
 +
{{#set: produced by=RXN-1102}}

Revision as of 15:44, 10 January 2018

Metabolite COUMARYL-ALCOHOL

  • smiles:
    • C(=CC1(=CC=C(O)C=C1))CO
  • inchi key:
    • InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
  • common name:
    • 4-coumaryl alcohol
  • molecular weight:
    • 150.177
  • Synonym(s):
    • p-coumaryl alcohol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5462&oldid=10181"