Difference between revisions of "P21-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Gene == Gene Tiso_gene_18096 == * left end position: ** 46 * transcription direction: ** NEGATIVE * right end position: ** 2799 * centisome position: ** 1.4132105...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18096 == |
− | * | + | * left end position: |
− | ** | + | ** 46 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2799 |
− | * | + | * centisome position: |
− | ** | + | ** 1.4132105 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.5.1.98-RXN]] |
− | * | + | ** in-silico_annotation |
− | * | + | ***ec-number |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * | + | == Pathways associated == |
− | * [[ | + | |
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=46}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2799}} | |
− | + | {{#set: centisome position=1.4132105 }} | |
− | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:46, 10 January 2018
Gene Tiso_gene_18096
- left end position:
- 46
- transcription direction:
- NEGATIVE
- right end position:
- 2799
- centisome position:
- 1.4132105
- Synonym(s):
Reactions associated
- 3.5.1.98-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation