Difference between revisions of "PWY-6708"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16101 == * Synonym(s): == Reactions associated == * 2.4.1.67-RXN ** pantograph-athaliana ** pantograph-esiliculosus **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == |
| + | * smiles: | ||
| + | ** C(CC(C(=O)[O-])[N+])(N)=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N | ||
| + | * common name: | ||
| + | ** L-asparagine | ||
| + | * molecular weight: | ||
| + | ** 132.119 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** asparagine | ||
| + | ** α-aminosuccinamic acid | ||
| + | ** (-)-asparagine | ||
| + | ** (S)-2,4-diamino-4-oxobutanoic acid | ||
| + | ** (S)-asparagine | ||
| + | ** 2,4-diamino-4-oxobutanoic acid, (S)- | ||
| + | ** 2-aminosuccinamic acid, L- | ||
| + | ** agedoite | ||
| + | ** altheine | ||
| + | ** asparagine acid | ||
| + | ** aspartic acid β-amide | ||
| + | ** butanoic acid, 2,4-diamino-4-oxo-, (S)- | ||
| + | ** L-2,4-diamino-4-oxobutanoic acid | ||
| + | ** L-asparatamine | ||
| + | ** L-β-asparagine | ||
| + | ** asn | ||
| + | ** N | ||
| + | ** L-asn | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ASPARAGHYD-RXN]] |
| − | + | * [[ASPARAGINE--TRNA-LIGASE-RXN]] | |
| − | + | * [[RME144]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-12460]] | |
| − | + | * [[ASNSYNA-RXN]] | |
| − | + | * [[ASNSYNB-RXN]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 70-47-3 |
| − | {{#set: | + | * METABOLIGHTS : MTBLC58048 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992089 6992089] | ||
| + | * HMDB : HMDB00168 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00152 C00152] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58048 58048] | ||
| + | * BIGG : asn__L | ||
| + | {{#set: smiles=C(CC(C(=O)[O-])[N+])(N)=O}} | ||
| + | {{#set: inchi key=InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N}} | ||
| + | {{#set: common name=L-asparagine}} | ||
| + | {{#set: molecular weight=132.119 }} | ||
| + | {{#set: common name=asparagine|α-aminosuccinamic acid|(-)-asparagine|(S)-2,4-diamino-4-oxobutanoic acid|(S)-asparagine|2,4-diamino-4-oxobutanoic acid, (S)-|2-aminosuccinamic acid, L-|agedoite|altheine|asparagine acid|aspartic acid β-amide|butanoic acid, 2,4-diamino-4-oxo-, (S)-|L-2,4-diamino-4-oxobutanoic acid|L-asparatamine|L-β-asparagine|asn|N|L-asn}} | ||
| + | {{#set: consumed by=ASPARAGHYD-RXN|ASPARAGINE--TRNA-LIGASE-RXN|RME144}} | ||
| + | {{#set: produced by=RXN-12460|ASNSYNA-RXN|ASNSYNB-RXN}} | ||
Revision as of 15:46, 10 January 2018
Contents
Metabolite ASN
- smiles:
- C(CC(C(=O)[O-])[N+])(N)=O
- inchi key:
- InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N
- common name:
- L-asparagine
- molecular weight:
- 132.119
- Synonym(s):
- asparagine
- α-aminosuccinamic acid
- (-)-asparagine
- (S)-2,4-diamino-4-oxobutanoic acid
- (S)-asparagine
- 2,4-diamino-4-oxobutanoic acid, (S)-
- 2-aminosuccinamic acid, L-
- agedoite
- altheine
- asparagine acid
- aspartic acid β-amide
- butanoic acid, 2,4-diamino-4-oxo-, (S)-
- L-2,4-diamino-4-oxobutanoic acid
- L-asparatamine
- L-β-asparagine
- asn
- N
- L-asn
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 70-47-3
- METABOLIGHTS : MTBLC58048
- PUBCHEM:
- HMDB : HMDB00168
- LIGAND-CPD:
- CHEBI:
- BIGG : asn__L
"C(CC(C(=O)[O-])[N+])(N)=O" cannot be used as a page name in this wiki.
