|
|
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCINE--TRNA-LIGASE-RXN GLYCINE--TRNA-LIGASE-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == |
| − | * direction: | + | * smiles: |
| − | ** LEFT-TO-RIGHT | + | ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45)))) |
| | + | * inchi key: |
| | + | ** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N |
| | * common name: | | * common name: |
| − | ** glycyl-trna_synthetase | + | ** 26,27-dehydrozymosterol |
| − | ** ORF | + | * molecular weight: |
| − | * ec number:
| + | ** 382.628 |
| − | ** [http://enzyme.expasy.org/EC/6.1.1.14 EC-6.1.1.14] | + | |
| | * Synonym(s): | | * Synonym(s): |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | * [[RXN-11201]] |
| − | ** 1 [[GLY-tRNAs]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[Charged-GLY-tRNAs]][c]
| + | == Reaction(s) known to produce the compound == |
| − | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
| − | ** 1 a tRNAgly[c] '''+''' 1 glycine[c] '''+''' 1 ATP[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 a glycyl-[tRNAgly][c]
| + | |
| − | | + | |
| − | == Genes associated with this reaction == | + | |
| − | Genes have been associated with this reaction based on different elements listed below.
| + | |
| − | * [[Tiso_gene_14742]] | + | |
| − | ** EXPERIMENTAL_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | * [[Tiso_gene_14743]]
| + | |
| − | ** IN-SILICO_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_3788]]
| + | |
| − | ** IN-SILICO_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | ** EXPERIMENTAL_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | == Pathways == | + | |
| − | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY]
| + | |
| − | ** '''21''' reactions found over '''21''' reactions in the full pathway
| + | |
| − | == Reconstruction information == | + | |
| − | * [[orthology]]:
| + | |
| − | ** [[pantograph]]:
| + | |
| − | *** [[esiliculosus]]
| + | |
| − | * [[annotation]]:
| + | |
| − | ** [[pathwaytools]]:
| + | |
| − | *** [[experimental_annotation]]
| + | |
| − | *** [[in-silico_annotation]]
| + | |
| | == External links == | | == External links == |
| − | * RHEA: | + | * PUBCHEM: |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16013 16013] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155] |
| − | * LIGAND-RXN:
| + | {{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03654 R03654]
| + | {{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}} |
| − | * UNIPROT:
| + | {{#set: common name=26,27-dehydrozymosterol}} |
| − | ** [http://www.uniprot.org/uniprot/P41250 P41250]
| + | {{#set: molecular weight=382.628 }} |
| − | ** [http://www.uniprot.org/uniprot/P54380 P54380]
| + | {{#set: consumed by=RXN-11201}} |
| − | ** [http://www.uniprot.org/uniprot/Q9ZCB1 Q9ZCB1]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P43822 P43822]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P54381 P54381]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O51344 O51344]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q46371 Q46371]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9ZCB0 Q9ZCB0]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9WY59 Q9WY59]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P43821 P43821]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O83678 O83678]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9WY60 Q9WY60]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9PPK3 Q9PPK3]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P56454 P56454]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9PN63 Q9PN63]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q57681 Q57681]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P67029 P67029]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O67081 O67081]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O67898 O67898]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O59235 O59235]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P47493 P47493]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9ZKP1 Q9ZKP1]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9JW67 Q9JW67]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P56453 P56453]
| + | |
| − | ** [http://www.uniprot.org/uniprot/O27874 O27874]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9ZKM9 Q9ZKM9]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9CGK0 Q9CGK0]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P38088 P38088]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q06817 Q06817]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q51114 Q51114]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P75425 P75425]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q55716 Q55716]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P00960 P00960]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P00961 P00961]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q8L785 Q8L785]
| + | |
| − | {{#set: direction=LEFT-TO-RIGHT}}
| + | |
| − | {{#set: common name=glycyl-trna_synthetase}} | + | |
| − | {{#set: common name=ORF}} | + | |
| − | {{#set: ec number=EC-6.1.1.14}} | + | |
| − | {{#set: gene associated=Tiso_gene_14742|Tiso_gene_14743|Tiso_gene_3788}} | + | |
| − | {{#set: in pathway=TRNA-CHARGING-PWY}}
| + | |
| − | {{#set: reconstruction category=orthology}}
| + | |
| − | {{#set: reconstruction tool=pantograph}}
| + | |
| − | {{#set: reconstruction source=esiliculosus}}
| + | |
| − | {{#set: reconstruction category=annotation}}
| + | |
| − | {{#set: reconstruction tool=pathwaytools}}
| + | |
| − | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |
