Difference between revisions of "PWY3O-355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12093 RXN-12093] == * direction: ** LEFT-TO-RIGHT * common name: ** 7-cyano-7-deazaguanine_synt...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12093 RXN-12093] ==
−
* smiles:
+
* direction:
−
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
+
 
* common name:
 
* common name:
−
** cellotetraose
+
** 7-cyano-7-deazaguanine_synthase
−
* molecular weight:
+
* ec number:
−
** 666.583   
+
** [http://enzyme.expasy.org/EC/6.3.4.20 EC-6.3.4.20]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12305]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[CPD-13043]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[7-CYANO-7-DEAZAGUANINE]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 ammonium[c] '''+''' 1 7-carboxy-7-deazaguanine[c] '''=>''' 1 H+[c] '''+''' 1 preQ0[c] '''+''' 1 ADP[c] '''+''' 1 H2O[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10965]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6703]], preQ0 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6703 PWY-6703]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27982 27982]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
+
{{#set: common name=7-cyano-7-deazaguanine_synthase}}
−
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
+
{{#set: ec number=EC-6.3.4.20}}
−
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
+
{{#set: gene associated=Tiso_gene_10965}}
−
{{#set: common name=cellotetraose}}
+
{{#set: in pathway=PWY-6703}}
−
{{#set: molecular weight=666.583    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: consumed by=RXN-12305}}
+
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=in-silico_annotation}}

Revision as of 15:46, 10 January 2018

Reaction RXN-12093

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 7-cyano-7-deazaguanine_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6703, preQ0 biosynthesis: PWY-6703
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY3O-355&oldid=10353"