Difference between revisions of "HOMOSERDEAM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CL- ExchangeSeed_CL-] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_CL- ExchangeSeed_CL-] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
 +
* inchi key:
 +
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
 +
* common name:
 +
** cellotetraose
 +
* molecular weight:
 +
** 666.583   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12305]]
−
** 1.0 [[CL-]][C-BOUNDARY] '''<=>''' 1.0 [[CL-]][e]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 chloride[C-BOUNDARY] '''<=>''' 1.0 chloride[e]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[manual]]:
+
−
** [[added to manage seeds from boundary to extracellular compartment]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: in pathway=}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
−
{{#set: reconstruction category=manual}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=added to manage seeds from boundary to extracellular compartment}}
+
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
 +
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
 +
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
 +
{{#set: common name=cellotetraose}}
 +
{{#set: molecular weight=666.583    }}
 +
{{#set: consumed by=RXN-12305}}

Revision as of 15:47, 10 January 2018

Metabolite CPD-13205

  • smiles:
    • C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
  • inchi key:
    • InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
  • common name:
    • cellotetraose
  • molecular weight:
    • 666.583
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMOSERDEAM-RXN&oldid=10381"