Difference between revisions of "PWY-5283"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTCP DCTCP] == * direction: ** LEFT-TO-RIGHT * common name: ** dCTP:cytidine 5'-phosphotransferase...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCTCP DCTCP] ==
* smiles:
+
* direction:
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
+
 
* common name:
 
* common name:
** cathasterone
+
** dCTP:cytidine 5'-phosphotransferase
* molecular weight:
+
** 432.685   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-716]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[DCTP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DCDP]][c] '''+''' 1.0 [[CMP]][c]
* [[RXN-715]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 cytidine[c] '''+''' 1.0 dCTP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 dCDP[c] '''+''' 1.0 CMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_20134]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_14474]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086]
+
{{#set: common name=dCTP:cytidine 5'-phosphotransferase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction source=creinhardtii}}
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
+
{{#set: common name=cathasterone}}
+
{{#set: molecular weight=432.685    }}
+
{{#set: consumed by=RXN-716}}
+
{{#set: produced by=RXN-715}}
+

Revision as of 15:52, 10 January 2018

Reaction DCTCP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dCTP:cytidine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 cytidine[c] + 1.0 dCTP[c] => 1.0 H+[c] + 1.0 dCDP[c] + 1.0 CMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links